C34H29N3O7 — CID 3344918
[2-(4-nitrophenyl)-2-oxoethyl] 8-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3344918) has the molecular formula C34H29N3O7 and a molecular weight of 591.62 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 8-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 8-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3344918 |
| Molecular Formula | C34H29N3O7 |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 8-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | Cc1cccc2c(C(=O)OCC(=O)c3ccc([N+](=O)[O-])cc3)cc(-c3ccc(N4C(=O)C5CCC(C)CC5C4=O)cc3)nc12 |
| InChI | InChI=1S/C34H29N3O7/c1-19-6-15-26-27(16-19)33(40)36(32(26)39)23-11-7-21(8-12-23)29-17-28(25-5-3-4-20(2)31(25)35-29)34(41)44-18-30(38)22-9-13-24(14-10-22)37(42)43/h3-5,7-14,17,19,26-27H,6,15-16,18H2,1-2H3 |
| InChIKey | HLJFOIPBCTZOJK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|