C33H26ClFN2O5 — CID 5086488
[2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 5086488) has the molecular formula C33H26ClFN2O5 and a molecular weight of 585.03 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5086488 |
| Molecular Formula | C33H26ClFN2O5 |
| Molecular Weight | 585.03 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC1CCC2C(=O)N(c3ccc(-c4cc(C(=O)OCC(=O)c5ccc(F)cc5)c5cccc(Cl)c5n4)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C33H26ClFN2O5/c1-18-5-14-24-25(15-18)32(40)37(31(24)39)22-12-8-19(9-13-22)28-16-26(23-3-2-4-27(34)30(23)36-28)33(41)42-17-29(38)20-6-10-21(35)11-7-20/h2-4,6-13,16,18,24-25H,5,14-15,17H2,1H3 |
| InChIKey | RDMIIUMVURTWHG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.03 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|