C32H24ClFN2O5 — CID 3375984
[2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3375984) has the molecular formula C32H24ClFN2O5 and a molecular weight of 571.00 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3375984 |
| Molecular Formula | C32H24ClFN2O5 |
| Molecular Weight | 571.00 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(N3C(=O)C4CCCCC4C3=O)cc2)nc2c(Cl)cccc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C32H24ClFN2O5/c33-26-7-3-6-22-25(32(40)41-17-28(37)19-8-12-20(34)13-9-19)16-27(35-29(22)26)18-10-14-21(15-11-18)36-30(38)23-4-1-2-5-24(23)31(36)39/h3,6-16,23-24H,1-2,4-5,17H2 |
| InChIKey | HQXSRMGCKGXXDU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.00 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|