C32H22Br2ClFN2O5 — CID 4612641
[2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4612641) has the molecular formula C32H22Br2ClFN2O5 and a molecular weight of 728.80 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4612641 |
| Molecular Formula | C32H22Br2ClFN2O5 |
| Molecular Weight | 728.80 g/mol |
| Exact Mass | 725.96 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 8-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(N3C(=O)C4CC(Br)C(Br)CC4C3=O)cc2)nc2c(Cl)cccc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C32H22Br2ClFN2O5/c33-24-12-21-22(13-25(24)34)31(41)38(30(21)40)19-10-6-16(7-11-19)27-14-23(20-2-1-3-26(35)29(20)37-27)32(42)43-15-28(39)17-4-8-18(36)9-5-17/h1-11,14,21-22,24-25H,12-13,15H2 |
| InChIKey | ZQENXLLGXQIWTB-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.80 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|