C34H27Br3N2O6 — CID 4103497
[2-(4-methoxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 4103497) has the molecular formula C34H27Br3N2O6 and a molecular weight of 799.31 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4103497 |
| Molecular Formula | C34H27Br3N2O6 |
| Molecular Weight | 799.31 g/mol |
| Exact Mass | 795.94 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)C5CC(Br)C(Br)CC5C4=O)cc3)nc3c(C)cc(Br)cc23)cc1 |
| InChI | InChI=1S/C34H27Br3N2O6/c1-17-11-20(35)12-23-26(34(43)45-16-30(40)19-5-9-22(44-2)10-6-19)15-29(38-31(17)23)18-3-7-21(8-4-18)39-32(41)24-13-27(36)28(37)14-25(24)33(39)42/h3-12,15,24-25,27-28H,13-14,16H2,1-2H3 |
| InChIKey | QHRLJUHHAWKEQA-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.31 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|