C34H30N2O6 — CID 19646750
[2-(4-methoxyphenyl)-2-oxoethyl] 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 19646750) has the molecular formula C34H30N2O6 and a molecular weight of 562.62 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19646750 |
| Molecular Formula | C34H30N2O6 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)C5CCCCC5C4=O)cc3)nc3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C34H30N2O6/c1-20-7-16-29-27(17-20)28(34(40)42-19-31(37)22-10-14-24(41-2)15-11-22)18-30(35-29)21-8-12-23(13-9-21)36-32(38)25-5-3-4-6-26(25)33(36)39/h7-18,25-26H,3-6,19H2,1-2H3 |
| InChIKey | GMCNEASLLWPNHT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|