C32H25NO4 — CID 3591091
[2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylate (PubChem CID 3591091) has the molecular formula C32H25NO4 and a molecular weight of 487.56 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3591091 |
| Molecular Formula | C32H25NO4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCC(=O)c3ccc(-c4ccccc4)cc3)c3cc(C)ccc3n2)cc1 |
| InChI | InChI=1S/C32H25NO4/c1-21-8-17-29-27(18-21)28(19-30(33-29)24-13-15-26(36-2)16-14-24)32(35)37-20-31(34)25-11-9-23(10-12-25)22-6-4-3-5-7-22/h3-19H,20H2,1-2H3 |
| InChIKey | CXBIATYFKIBBSG-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |