C32H28N2O3 — CID 3744344
[2-(4-methylphenyl)-2-oxoethyl] 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 3744344) has the molecular formula C32H28N2O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3744344 |
| Molecular Formula | C32H28N2O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cc(-c3ccc(-n4c(C)ccc4C)cc3)nc3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C32H28N2O3/c1-20-5-10-25(11-6-20)31(35)19-37-32(36)28-18-30(33-29-16-7-21(2)17-27(28)29)24-12-14-26(15-13-24)34-22(3)8-9-23(34)4/h5-18H,19H2,1-4H3 |
| InChIKey | RNGSRBFRKKEFTL-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|