C31H29NO4 — CID 4516242
[2-(4-cyclohexylphenyl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate (PubChem CID 4516242) has the molecular formula C31H29NO4 and a molecular weight of 479.58 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4516242 |
| Molecular Formula | C31H29NO4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCC(=O)c3ccc(C4CCCCC4)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C31H29NO4/c1-35-25-17-15-23(16-18-25)29-19-27(26-9-5-6-10-28(26)32-29)31(34)36-20-30(33)24-13-11-22(12-14-24)21-7-3-2-4-8-21/h5-6,9-19,21H,2-4,7-8,20H2,1H3 |
| InChIKey | VKYSPWJDGLYVOE-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |