C25H26N2O4 — CID 2479385
[2-(azepan-1-yl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate (PubChem CID 2479385) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2479385 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCC(=O)N3CCCCCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-30-19-12-10-18(11-13-19)23-16-21(20-8-4-5-9-22(20)26-23)25(29)31-17-24(28)27-14-6-2-3-7-15-27/h4-5,8-13,16H,2-3,6-7,14-15,17H2,1H3 |
| InChIKey | RTXPEAJAIXNWCR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |