C24H23FN2O3 — CID 7780547
[2-(azepan-1-yl)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate (PubChem CID 7780547) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7780547 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCCCC1)c1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C24H23FN2O3/c25-18-11-9-17(10-12-18)22-15-20(19-7-3-4-8-21(19)26-22)24(29)30-16-23(28)27-13-5-1-2-6-14-27/h3-4,7-12,15H,1-2,5-6,13-14,16H2 |
| InChIKey | NAGQHLAGILJODL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |