C26H18N2O5 — CID 3995966
(1,3-dioxoisoindol-2-yl)methyl 2-(4-methoxyphenyl)quinoline-4-carboxylate (PubChem CID 3995966) has the molecular formula C26H18N2O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-(4-methoxyphenyl)quinoline-4-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-(4-methoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3995966 |
| Molecular Formula | C26H18N2O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-(4-methoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCN3C(=O)c4ccccc4C3=O)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H18N2O5/c1-32-17-12-10-16(11-13-17)23-14-21(18-6-4-5-9-22(18)27-23)26(31)33-15-28-24(29)19-7-2-3-8-20(19)25(28)30/h2-14H,15H2,1H3 |
| InChIKey | XFVUAIITORCFFH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|