C23H17NO4S — CID 2568832
(2-oxo-2-thiophen-2-ylethyl) 2-(4-methoxyphenyl)quinoline-4-carboxylate (PubChem CID 2568832) has the molecular formula C23H17NO4S and a molecular weight of 403.46 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 2-(4-methoxyphenyl)quinoline-4-carboxylate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 2-(4-methoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2568832 |
| Molecular Formula | C23H17NO4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 2-(4-methoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCC(=O)c3cccs3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H17NO4S/c1-27-16-10-8-15(9-11-16)20-13-18(17-5-2-3-6-19(17)24-20)23(26)28-14-21(25)22-7-4-12-29-22/h2-13H,14H2,1H3 |
| InChIKey | PNHLKONMTBOBRR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |