C24H19NO5 — CID 16568659
(2-methoxy-2-oxoethyl) 2-(6-methoxynaphthalen-2-yl)quinoline-4-carboxylate (PubChem CID 16568659) has the molecular formula C24H19NO5 and a molecular weight of 401.42 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-(6-methoxynaphthalen-2-yl)quinoline-4-carboxylate.
| Compound Name | (2-methoxy-2-oxoethyl) 2-(6-methoxynaphthalen-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16568659 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2-(6-methoxynaphthalen-2-yl)quinoline-4-carboxylate |
| SMILES | COC(=O)COC(=O)c1cc(-c2ccc3cc(OC)ccc3c2)nc2ccccc12 |
| InChI | InChI=1S/C24H19NO5/c1-28-18-10-9-15-11-17(8-7-16(15)12-18)22-13-20(24(27)30-14-23(26)29-2)19-5-3-4-6-21(19)25-22/h3-13H,14H2,1-2H3 |
| InChIKey | QWUJMHCDRXOJLJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |