C33H28N2O4 — CID 23988368
[2-(dibenzylamino)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate (PubChem CID 23988368) has the molecular formula C33H28N2O4 and a molecular weight of 516.60 g/mol. Its IUPAC name is [2-(dibenzylamino)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate.
| Compound Name | [2-(dibenzylamino)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 23988368 |
| Molecular Formula | C33H28N2O4 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | [2-(dibenzylamino)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCC(=O)N(Cc3ccccc3)Cc3ccccc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C33H28N2O4/c1-38-27-18-16-26(17-19-27)31-20-29(28-14-8-9-15-30(28)34-31)33(37)39-23-32(36)35(21-24-10-4-2-5-11-24)22-25-12-6-3-7-13-25/h2-20H,21-23H2,1H3 |
| InChIKey | XFMRXJORRDNGFP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |