C28H22N2O5 — CID 2353574
[2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(6-methoxynaphthalen-2-yl)quinoline-4-carboxylate (PubChem CID 2353574) has the molecular formula C28H22N2O5 and a molecular weight of 466.49 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(6-methoxynaphthalen-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(6-methoxynaphthalen-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2353574 |
| Molecular Formula | C28H22N2O5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(6-methoxynaphthalen-2-yl)quinoline-4-carboxylate |
| SMILES | COc1ccc2cc(-c3cc(C(=O)OCC(=O)NCc4ccco4)c4ccccc4n3)ccc2c1 |
| InChI | InChI=1S/C28H22N2O5/c1-33-21-11-10-18-13-20(9-8-19(18)14-21)26-15-24(23-6-2-3-7-25(23)30-26)28(32)35-17-27(31)29-16-22-5-4-12-34-22/h2-15H,16-17H2,1H3,(H,29,31) |
| InChIKey | XTGGZILUXPYNMN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |