C24H17N3O4S — CID 16528663
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate (PubChem CID 16528663) has the molecular formula C24H17N3O4S and a molecular weight of 443.48 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16528663 |
| Molecular Formula | C24H17N3O4S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCC(=O)Nc3sccc3C#N)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H17N3O4S/c1-30-17-8-6-15(7-9-17)21-12-19(18-4-2-3-5-20(18)26-21)24(29)31-14-22(28)27-23-16(13-25)10-11-32-23/h2-12H,14H2,1H3,(H,27,28) |
| InChIKey | JRCKQKFSVZKOHR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |