C19H14N2O4S — CID 8596720
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-methoxynaphthalene-1-carboxylate (PubChem CID 8596720) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-methoxynaphthalene-1-carboxylate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-methoxynaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 8596720 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-methoxynaphthalene-1-carboxylate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2sccc2C#N)c2ccccc12 |
| InChI | InChI=1S/C19H14N2O4S/c1-24-16-7-6-15(13-4-2-3-5-14(13)16)19(23)25-11-17(22)21-18-12(10-20)8-9-26-18/h2-9H,11H2,1H3,(H,21,22) |
| InChIKey | IBZRONDENAZORF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |