C15H12N2O4S2 — CID 11927035
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(R)-methylsulfinyl]benzoate (PubChem CID 11927035) has the molecular formula C15H12N2O4S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(R)-methylsulfinyl]benzoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(R)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11927035 |
| Molecular Formula | C15H12N2O4S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(R)-methylsulfinyl]benzoate |
| SMILES | C[S@@](=O)c1ccccc1C(=O)OCC(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C15H12N2O4S2/c1-23(20)12-5-3-2-4-11(12)15(19)21-9-13(18)17-14-10(8-16)6-7-22-14/h2-7H,9H2,1H3,(H,17,18)/t23-/m1/s1 |
| InChIKey | CWSCVNZVVUEQBJ-HSZRJFAPSA-N |
| XLogP | 2.15 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |