C16H14N2O4S2 — CID 11924968
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate (PubChem CID 11924968) has the molecular formula C16H14N2O4S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11924968 |
| Molecular Formula | C16H14N2O4S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate |
| SMILES | CC[S@@](=O)c1ccccc1C(=O)OCC(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C16H14N2O4S2/c1-2-24(21)13-6-4-3-5-12(13)16(20)22-10-14(19)18-15-11(9-17)7-8-23-15/h3-8H,2,10H2,1H3,(H,18,19)/t24-/m1/s1 |
| InChIKey | NDHHZHMETIXWCI-XMMPIXPASA-N |
| XLogP | 2.54 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |