C19H21NO5S — CID 11916256
[2-(4-ethoxyanilino)-2-oxoethyl] 2-[(S)-ethylsulfinyl]benzoate (PubChem CID 11916256) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl] 2-[(S)-ethylsulfinyl]benzoate.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl] 2-[(S)-ethylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11916256 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl] 2-[(S)-ethylsulfinyl]benzoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2ccccc2[S@@](=O)CC)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-3-24-15-11-9-14(10-12-15)20-18(21)13-25-19(22)16-7-5-6-8-17(16)26(23)4-2/h5-12H,3-4,13H2,1-2H3,(H,20,21)/t26-/m0/s1 |
| InChIKey | IAUBUARLLLRDFQ-SANMLTNESA-N |
| XLogP | 3.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |