C24H23NO5S — CID 18194187
[2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] 2-ethylsulfinylbenzoate (PubChem CID 18194187) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is [2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] 2-ethylsulfinylbenzoate.
| Compound Name | [2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] 2-ethylsulfinylbenzoate |
|---|---|
| PubChem CID | 18194187 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] 2-ethylsulfinylbenzoate |
| SMILES | CCS(=O)c1ccccc1C(=O)OCC(=O)Nc1ccc(Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23NO5S/c1-3-31(28)22-7-5-4-6-21(22)24(27)29-16-23(26)25-18-10-14-20(15-11-18)30-19-12-8-17(2)9-13-19/h4-15H,3,16H2,1-2H3,(H,25,26) |
| InChIKey | MQTQRXCMWIZNEO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |