C18H17F2NO5 — CID 2691792
[2-(4-ethoxyanilino)-2-oxoethyl] 2-(difluoromethoxy)benzoate (PubChem CID 2691792) has the molecular formula C18H17F2NO5 and a molecular weight of 365.33 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl] 2-(difluoromethoxy)benzoate.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl] 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 2691792 |
| Molecular Formula | C18H17F2NO5 |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl] 2-(difluoromethoxy)benzoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2ccccc2OC(F)F)cc1 |
| InChI | InChI=1S/C18H17F2NO5/c1-2-24-13-9-7-12(8-10-13)21-16(22)11-25-17(23)14-5-3-4-6-15(14)26-18(19)20/h3-10,18H,2,11H2,1H3,(H,21,22) |
| InChIKey | GXOVVIAGCOEHIU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |