C24H25N3O5 — CID 42967523
[2-(2-ethoxyanilino)-2-oxoethyl] 2-(4-ethoxyanilino)pyridine-3-carboxylate (PubChem CID 42967523) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-(4-ethoxyanilino)pyridine-3-carboxylate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-(4-ethoxyanilino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 42967523 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-(4-ethoxyanilino)pyridine-3-carboxylate |
| SMILES | CCOc1ccc(Nc2ncccc2C(=O)OCC(=O)Nc2ccccc2OCC)cc1 |
| InChI | InChI=1S/C24H25N3O5/c1-3-30-18-13-11-17(12-14-18)26-23-19(8-7-15-25-23)24(29)32-16-22(28)27-20-9-5-6-10-21(20)31-4-2/h5-15H,3-4,16H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | JEVFDEPKYPTLRV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |