C27H28N2O6S — CID 3503829
[2-(2-ethoxyanilino)-2-oxoethyl] 2-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 3503829) has the molecular formula C27H28N2O6S and a molecular weight of 508.60 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 3503829 |
| Molecular Formula | C27H28N2O6S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)c1ccccc1SCC(=O)Nc1ccccc1OCC |
| InChI | InChI=1S/C27H28N2O6S/c1-3-33-22-14-8-6-12-20(22)28-25(30)17-35-27(32)19-11-5-10-16-24(19)36-18-26(31)29-21-13-7-9-15-23(21)34-4-2/h5-16H,3-4,17-18H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | HRKCXLWKEWBLRE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |