C22H25NO5S — CID 8733260
[2-(2-ethoxyanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate (PubChem CID 8733260) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 8733260 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)c1ccccc1SC[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H25NO5S/c1-2-26-19-11-5-4-10-18(19)23-21(24)14-28-22(25)17-9-3-6-12-20(17)29-15-16-8-7-13-27-16/h3-6,9-12,16H,2,7-8,13-15H2,1H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | QGJBGMLXROWTLD-INIZCTEOSA-N |
| XLogP | 4.15 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |