C20H28N2O5S — CID 8733749
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzoate (PubChem CID 8733749) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzoate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 8733749 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzoate |
| SMILES | CC(C)CCNC(=O)NC(=O)COC(=O)c1ccccc1SC[C@H]1CCCO1 |
| InChI | InChI=1S/C20H28N2O5S/c1-14(2)9-10-21-20(25)22-18(23)12-27-19(24)16-7-3-4-8-17(16)28-13-15-6-5-11-26-15/h3-4,7-8,14-15H,5-6,9-13H2,1-2H3,(H2,21,22,23,25)/t15-/m1/s1 |
| InChIKey | JQEQHZIIATXSPD-OAHLLOKOSA-N |
| XLogP | 2.99 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |