C20H20ClNO4S — CID 8733127
[2-(3-chloroanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate (PubChem CID 8733127) has the molecular formula C20H20ClNO4S and a molecular weight of 405.90 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 8733127 |
| Molecular Formula | C20H20ClNO4S |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1SC[C@@H]1CCCO1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClNO4S/c21-14-5-3-6-15(11-14)22-19(23)12-26-20(24)17-8-1-2-9-18(17)27-13-16-7-4-10-25-16/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2,(H,22,23)/t16-/m0/s1 |
| InChIKey | RFNCDOJHPGDNJG-INIZCTEOSA-N |
| XLogP | 4.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |