C22H24N2O6S — CID 55403758
[2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate (PubChem CID 55403758) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate.
| Compound Name | [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 55403758 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
| SMILES | COc1ccc(NC(=O)NC(=O)COC(=O)c2ccccc2SCC2CCCO2)cc1 |
| InChI | InChI=1S/C22H24N2O6S/c1-28-16-10-8-15(9-11-16)23-22(27)24-20(25)13-30-21(26)18-6-2-3-7-19(18)31-14-17-5-4-12-29-17/h2-3,6-11,17H,4-5,12-14H2,1H3,(H2,23,24,25,27) |
| InChIKey | FEPXERNHGHMEFN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |