C21H23NO5S — CID 55403738
[2-(4-methoxyanilino)-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate (PubChem CID 55403738) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 55403738 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccccc2SCC2CCCO2)cc1 |
| InChI | InChI=1S/C21H23NO5S/c1-25-16-10-8-15(9-11-16)22-20(23)13-27-21(24)18-6-2-3-7-19(18)28-14-17-5-4-12-26-17/h2-3,6-11,17H,4-5,12-14H2,1H3,(H,22,23) |
| InChIKey | KPFZJJSFEAKBES-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |