C25H30N2O5S — CID 55405386
[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate (PubChem CID 55405386) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate.
| Compound Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 55405386 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)COC(=O)c2ccccc2SCC2CCCO2)c1 |
| InChI | InChI=1S/C25H30N2O5S/c1-3-27(4-2)24(29)18-9-7-10-19(15-18)26-23(28)16-32-25(30)21-12-5-6-13-22(21)33-17-20-11-8-14-31-20/h5-7,9-10,12-13,15,20H,3-4,8,11,14,16-17H2,1-2H3,(H,26,28) |
| InChIKey | MZPIBGBDQIRMKP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |