C17H11N3O4S — CID 2626977
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 2626977) has the molecular formula C17H11N3O4S and a molecular weight of 353.36 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2626977 |
| Molecular Formula | C17H11N3O4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H11N3O4S/c18-8-10-5-6-25-16(10)20-15(22)9-24-17(23)12-7-14(21)19-13-4-2-1-3-11(12)13/h1-7H,9H2,(H,19,21)(H,20,22) |
| InChIKey | HABAGLBLKFSXRW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |