C29H19N3O3S — CID 16528654
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-(4-phenylphenyl)quinoline-4-carboxylate (PubChem CID 16528654) has the molecular formula C29H19N3O3S and a molecular weight of 489.56 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-(4-phenylphenyl)quinoline-4-carboxylate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-(4-phenylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16528654 |
| Molecular Formula | C29H19N3O3S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-(4-phenylphenyl)quinoline-4-carboxylate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)c1cc(-c2ccc(-c3ccccc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C29H19N3O3S/c30-17-22-14-15-36-28(22)32-27(33)18-35-29(34)24-16-26(31-25-9-5-4-8-23(24)25)21-12-10-20(11-13-21)19-6-2-1-3-7-19/h1-16H,18H2,(H,32,33) |
| InChIKey | HPFXCECSWQXYKB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |