C26H19N3O4 — CID 16528678
[2-(2-cyanoanilino)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate (PubChem CID 16528678) has the molecular formula C26H19N3O4 and a molecular weight of 437.46 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16528678 |
| Molecular Formula | C26H19N3O4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCC(=O)Nc3ccccc3C#N)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H19N3O4/c1-32-19-12-10-17(11-13-19)24-14-21(20-7-3-5-9-23(20)28-24)26(31)33-16-25(30)29-22-8-4-2-6-18(22)15-27/h2-14H,16H2,1H3,(H,29,30) |
| InChIKey | JTYKRJCVYWYFNK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |