C18H11F3N2O4 — CID 2413178
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 2413178) has the molecular formula C18H11F3N2O4 and a molecular weight of 376.29 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2413178 |
| Molecular Formula | C18H11F3N2O4 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)[nH]c2ccccc12)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H11F3N2O4/c19-11-5-6-13(17(21)16(11)20)23-15(25)8-27-18(26)10-7-14(24)22-12-4-2-1-3-9(10)12/h1-7H,8H2,(H,22,24)(H,23,25) |
| InChIKey | OCDAVVGGMZYHFR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|