C19H14F2N2O5 — CID 2387654
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 2387654) has the molecular formula C19H14F2N2O5 and a molecular weight of 388.33 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2387654 |
| Molecular Formula | C19H14F2N2O5 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)[nH]c2ccccc12)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H14F2N2O5/c20-19(21)28-15-8-4-3-7-14(15)23-17(25)10-27-18(26)12-9-16(24)22-13-6-2-1-5-11(12)13/h1-9,19H,10H2,(H,22,24)(H,23,25) |
| InChIKey | QYRAUBFHPLRIBY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |