C15H12F2N2O5 — CID 2373487
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate (PubChem CID 2373487) has the molecular formula C15H12F2N2O5 and a molecular weight of 338.27 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2373487 |
| Molecular Formula | C15H12F2N2O5 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc[nH]c1=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H12F2N2O5/c16-15(17)24-11-6-2-1-5-10(11)19-12(20)8-23-14(22)9-4-3-7-18-13(9)21/h1-7,15H,8H2,(H,18,21)(H,19,20) |
| InChIKey | RFDPHHOLTLQKMR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |