C23H18ClF2NO5 — CID 2399403
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-[(4-chlorophenyl)methoxy]benzoate (PubChem CID 2399403) has the molecular formula C23H18ClF2NO5 and a molecular weight of 461.85 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-[(4-chlorophenyl)methoxy]benzoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-[(4-chlorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 2399403 |
| Molecular Formula | C23H18ClF2NO5 |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-[(4-chlorophenyl)methoxy]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1OCc1ccc(Cl)cc1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C23H18ClF2NO5/c24-16-11-9-15(10-12-16)13-30-19-7-3-1-5-17(19)22(29)31-14-21(28)27-18-6-2-4-8-20(18)32-23(25)26/h1-12,23H,13-14H2,(H,27,28) |
| InChIKey | KLXZCTHBWXPTTD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |