C16H12F2INO4 — CID 2397956
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-iodobenzoate (PubChem CID 2397956) has the molecular formula C16H12F2INO4 and a molecular weight of 447.18 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-iodobenzoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 2397956 |
| Molecular Formula | C16H12F2INO4 |
| Molecular Weight | 447.18 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-iodobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1I)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C16H12F2INO4/c17-16(18)24-13-8-4-3-7-12(13)20-14(21)9-23-15(22)10-5-1-2-6-11(10)19/h1-8,16H,9H2,(H,20,21) |
| InChIKey | WHRFRLLTDCCJQA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.18 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|