C20H15F2NO6 — CID 7228474
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 7228474) has the molecular formula C20H15F2NO6 and a molecular weight of 403.34 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7228474 |
| Molecular Formula | C20H15F2NO6 |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(O)c2ccccc2c1O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C20H15F2NO6/c21-20(22)29-16-8-4-3-7-14(16)23-17(25)10-28-19(27)13-9-15(24)11-5-1-2-6-12(11)18(13)26/h1-9,20,24,26H,10H2,(H,23,25) |
| InChIKey | SEXYCIRDCQSMQB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|