C16H11BrClF2NO4 — CID 2400404
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-bromo-2-chlorobenzoate (PubChem CID 2400404) has the molecular formula C16H11BrClF2NO4 and a molecular weight of 434.62 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-bromo-2-chlorobenzoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-bromo-2-chlorobenzoate |
|---|---|
| PubChem CID | 2400404 |
| Molecular Formula | C16H11BrClF2NO4 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 432.95 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-bromo-2-chlorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Br)ccc1Cl)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C16H11BrClF2NO4/c17-9-5-6-11(18)10(7-9)15(23)24-8-14(22)21-12-3-1-2-4-13(12)25-16(19)20/h1-7,16H,8H2,(H,21,22) |
| InChIKey | HUFCHSHTWKHLSF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |