C15H10N4O3S — CID 2626907
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 2626907) has the molecular formula C15H10N4O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 2626907 |
| Molecular Formula | C15H10N4O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C15H10N4O3S/c16-7-9-5-6-23-14(9)17-12(20)8-22-15(21)13-10-3-1-2-4-11(10)18-19-13/h1-6H,8H2,(H,17,20)(H,18,19) |
| InChIKey | ZZXYFNJZELMBMD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |