C15H11BrN2O4S — CID 8875978
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-bromo-4-methoxybenzoate (PubChem CID 8875978) has the molecular formula C15H11BrN2O4S and a molecular weight of 395.23 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-bromo-4-methoxybenzoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-bromo-4-methoxybenzoate |
|---|---|
| PubChem CID | 8875978 |
| Molecular Formula | C15H11BrN2O4S |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-bromo-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2sccc2C#N)cc1Br |
| InChI | InChI=1S/C15H11BrN2O4S/c1-21-12-3-2-9(6-11(12)16)15(20)22-8-13(19)18-14-10(7-17)4-5-23-14/h2-6H,8H2,1H3,(H,18,19) |
| InChIKey | GUJYRMRYTIIEPH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |