C15H11N3O6S — CID 30122780
methyl 4-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethoxy]-3-nitrobenzoate (PubChem CID 30122780) has the molecular formula C15H11N3O6S and a molecular weight of 361.34 g/mol. Its IUPAC name is methyl 4-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethoxy]-3-nitrobenzoate.
| Compound Name | methyl 4-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethoxy]-3-nitrobenzoate |
|---|---|
| PubChem CID | 30122780 |
| Molecular Formula | C15H11N3O6S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | methyl 4-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethoxy]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)Nc2sccc2C#N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11N3O6S/c1-23-15(20)9-2-3-12(11(6-9)18(21)22)24-8-13(19)17-14-10(7-16)4-5-25-14/h2-6H,8H2,1H3,(H,17,19) |
| InChIKey | IEURKFOYFXXCKR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|