C13H8BrClN2O2S — CID 2117847
2-(2-bromo-4-chlorophenoxy)-N-(3-cyanothiophen-2-yl)acetamide (PubChem CID 2117847) has the molecular formula C13H8BrClN2O2S and a molecular weight of 371.64 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-(3-cyanothiophen-2-yl)acetamide.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-(3-cyanothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 2117847 |
| Molecular Formula | C13H8BrClN2O2S |
| Molecular Weight | 371.64 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-(3-cyanothiophen-2-yl)acetamide |
| SMILES | N#Cc1ccsc1NC(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H8BrClN2O2S/c14-10-5-9(15)1-2-11(10)19-7-12(18)17-13-8(6-16)3-4-20-13/h1-5H,7H2,(H,17,18) |
| InChIKey | FQCJVMHUPQFFHV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |