C14H10BrClN2O2S — CID 8728164
(2S)-2-(2-bromo-4-chlorophenoxy)-N-(3-cyanothiophen-2-yl)propanamide (PubChem CID 8728164) has the molecular formula C14H10BrClN2O2S and a molecular weight of 385.67 g/mol. Its IUPAC name is (2S)-2-(2-bromo-4-chlorophenoxy)-N-(3-cyanothiophen-2-yl)propanamide.
| Compound Name | (2S)-2-(2-bromo-4-chlorophenoxy)-N-(3-cyanothiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 8728164 |
| Molecular Formula | C14H10BrClN2O2S |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | (2S)-2-(2-bromo-4-chlorophenoxy)-N-(3-cyanothiophen-2-yl)propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Br)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C14H10BrClN2O2S/c1-8(20-12-3-2-10(16)6-11(12)15)13(19)18-14-9(7-17)4-5-21-14/h2-6,8H,1H3,(H,18,19)/t8-/m0/s1 |
| InChIKey | FPAKRZPBLCPKIU-QMMMGPOBSA-N |
| XLogP | 4.44 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |