C16H13FN2O4S — CID 9310117
[(2S)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 3-fluoro-4-methoxybenzoate (PubChem CID 9310117) has the molecular formula C16H13FN2O4S and a molecular weight of 348.36 g/mol. Its IUPAC name is [(2S)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 3-fluoro-4-methoxybenzoate.
| Compound Name | [(2S)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 3-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 9310117 |
| Molecular Formula | C16H13FN2O4S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [(2S)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 3-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@@H](C)C(=O)Nc2sccc2C#N)cc1F |
| InChI | InChI=1S/C16H13FN2O4S/c1-9(14(20)19-15-11(8-18)5-6-24-15)23-16(21)10-3-4-13(22-2)12(17)7-10/h3-7,9H,1-2H3,(H,19,20)/t9-/m0/s1 |
| InChIKey | KKRSNEZNMYPTKY-VIFPVBQESA-N |
| XLogP | 2.95 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |