C16H12N6O3S — CID 8953274
[(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate (PubChem CID 8953274) has the molecular formula C16H12N6O3S and a molecular weight of 368.38 g/mol. Its IUPAC name is [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate.
| Compound Name | [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 8953274 |
| Molecular Formula | C16H12N6O3S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(-n2cnnn2)cc1)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C16H12N6O3S/c1-10(14(23)19-15-12(8-17)6-7-26-15)25-16(24)11-2-4-13(5-3-11)22-9-18-20-21-22/h2-7,9-10H,1H3,(H,19,23)/t10-/m1/s1 |
| InChIKey | JHNWGCRFMZAIKG-SNVBAGLBSA-N |
| XLogP | 1.78 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |