C16H14N4O4S — CID 45353803
[1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(carbamoylamino)benzoate (PubChem CID 45353803) has the molecular formula C16H14N4O4S and a molecular weight of 358.38 g/mol. Its IUPAC name is [1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(carbamoylamino)benzoate.
| Compound Name | [1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 45353803 |
| Molecular Formula | C16H14N4O4S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(carbamoylamino)benzoate |
| SMILES | CC(OC(=O)c1ccc(NC(N)=O)cc1)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C16H14N4O4S/c1-9(13(21)20-14-11(8-17)6-7-25-14)24-15(22)10-2-4-12(5-3-10)19-16(18)23/h2-7,9H,1H3,(H,20,21)(H3,18,19,23) |
| InChIKey | SWMDWFHODRCOMS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |