C16H14N2O4S — CID 8550104
[(2S)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate (PubChem CID 8550104) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is [(2S)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate.
| Compound Name | [(2S)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 8550104 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [(2S)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@@H](C)C(=O)Nc2sccc2C#N)c(O)c1 |
| InChI | InChI=1S/C16H14N2O4S/c1-9-3-4-12(13(19)7-9)16(21)22-10(2)14(20)18-15-11(8-17)5-6-23-15/h3-7,10,19H,1-2H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | MEUSFCFFCOEJMJ-JTQLQIEISA-N |
| XLogP | 2.82 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |